C31H31FN4O3 — CID 58073257
2-[1-(4-fluorophenyl)piperidin-4-yl]-1-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethanone (PubChem CID 58073257) has the molecular formula C31H31FN4O3 and a molecular weight of 526.61 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)piperidin-4-yl]-1-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethanone.
| Compound Name | 2-[1-(4-fluorophenyl)piperidin-4-yl]-1-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 58073257 |
| Molecular Formula | C31H31FN4O3 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 2-[1-(4-fluorophenyl)piperidin-4-yl]-1-[6-[4-(4-isocyanophenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethanone |
| SMILES | [C-]#[N+]c1ccc(OC2CCN(C(=O)c3ccc(C(=O)CC4CCN(c5ccc(F)cc5)CC4)cn3)CC2)cc1 |
| InChI | InChI=1S/C31H31FN4O3/c1-33-25-5-9-27(10-6-25)39-28-14-18-36(19-15-28)31(38)29-11-2-23(21-34-29)30(37)20-22-12-16-35(17-13-22)26-7-3-24(32)4-8-26/h2-11,21-22,28H,12-20H2 |
| InChIKey | DMJSHYWBFOTQQZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|