C18H21N5O — CID 58073678
5-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylpyrimidin-5-yl]ethynyl]pyridin-2-amine (PubChem CID 58073678) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylpyrimidin-5-yl]ethynyl]pyridin-2-amine.
| Compound Name | 5-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylpyrimidin-5-yl]ethynyl]pyridin-2-amine |
|---|---|
| PubChem CID | 58073678 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 5-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-methylpyrimidin-5-yl]ethynyl]pyridin-2-amine |
| SMILES | Cc1ncnc(N2C[C@@H](C)O[C@@H](C)C2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C18H21N5O/c1-12-9-23(10-13(2)24-12)18-16(14(3)21-11-22-18)6-4-15-5-7-17(19)20-8-15/h5,7-8,11-13H,9-10H2,1-3H3,(H2,19,20)/t12-,13+ |
| InChIKey | BTQGTEOACTXARD-BETUJISGSA-N |
| XLogP | 1.78 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|