About 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one
1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one (PubChem CID 58073702) has the molecular formula C17H18N6O
and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one |
| PubChem CID | 58073702 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one |
| SMILES | Cc1ncnc(N2CCNC(=O)CC2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C17H18N6O/c1-12-14(4-2-13-3-5-15(18)20-10-13)17(22-11-21-12)23-8-6-16(24)19-7-9-23/h3,5,10-11H,6-9H2,1H3,(H2,18,20)(H,19,24) |
| InChIKey | GYZGMOYNXRXELF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one?
The IUPAC name of 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one (CID 58073702) is 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one?
The canonical SMILES for 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one is Cc1ncnc(N2CCNC(=O)CC2)c1C#Cc1ccc(N)nc1.
What is the InChIKey of 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one?
The InChIKey is GYZGMOYNXRXELF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N6O/c1-12-14(4-2-13-3-5-15(18)20-10-13)17(22-11-21-12)23-8-6-16(24)19-7-9-23/h3,5,10-11H,6-9H2,1H3,(H2,18,20)(H,19,24).
What are the key properties of 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one?
1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one has a molecular weight of 322.37 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-methylpyrimidin-4-yl]-1,4-diazepan-5-one is sourced from PubChem (CID 58073702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).