C22H27N5 — CID 58073704
5-[2-[4-ethyl-6-[4-(2-methylprop-1-enyl)piperidin-1-yl]pyrimidin-5-yl]ethynyl]pyridin-2-amine (PubChem CID 58073704) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 5-[2-[4-ethyl-6-[4-(2-methylprop-1-enyl)piperidin-1-yl]pyrimidin-5-yl]ethynyl]pyridin-2-amine.
| Compound Name | 5-[2-[4-ethyl-6-[4-(2-methylprop-1-enyl)piperidin-1-yl]pyrimidin-5-yl]ethynyl]pyridin-2-amine |
|---|---|
| PubChem CID | 58073704 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 5-[2-[4-ethyl-6-[4-(2-methylprop-1-enyl)piperidin-1-yl]pyrimidin-5-yl]ethynyl]pyridin-2-amine |
| SMILES | CCc1ncnc(N2CCC(C=C(C)C)CC2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C22H27N5/c1-4-20-19(7-5-18-6-8-21(23)24-14-18)22(26-15-25-20)27-11-9-17(10-12-27)13-16(2)3/h6,8,13-15,17H,4,9-12H2,1-3H3,(H2,23,24) |
| InChIKey | WPKCXIBHOZSFMI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|