C23H29ClN2S — CID 58074018
1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-3,3-dimethylbutane-1-thione (PubChem CID 58074018) has the molecular formula C23H29ClN2S and a molecular weight of 401.02 g/mol. Its IUPAC name is 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-3,3-dimethylbutane-1-thione.
| Compound Name | 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-3,3-dimethylbutane-1-thione |
|---|---|
| PubChem CID | 58074018 |
| Molecular Formula | C23H29ClN2S |
| Molecular Weight | 401.02 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-3,3-dimethylbutane-1-thione |
| SMILES | CC(C)(C)CC(=S)c1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1 |
| InChI | InChI=1S/C23H29ClN2S/c1-23(2,3)14-21(27)18-6-4-16(5-7-18)15-26-22-19-11-13-25-12-10-17(19)8-9-20(22)24/h4-9,25-26H,10-15H2,1-3H3 |
| InChIKey | DZNALKOAFMOPIH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.02 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|