About 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole
3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole (PubChem CID 58074465) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole.
Molecular Properties
| Compound Name | 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole |
| PubChem CID | 58074465 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole |
| SMILES | C=C1NNC(CC)=C1C |
| InChI | InChI=1S/C7H12N2/c1-4-7-5(2)6(3)8-9-7/h8-9H,3-4H2,1-2H3 |
| InChIKey | CHXHQPMKZWSUHE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole?
The IUPAC name of 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole (CID 58074465) is 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole.
What is the SMILES notation for 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole?
The canonical SMILES for 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole is C=C1NNC(CC)=C1C.
What is the InChIKey of 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole?
The InChIKey is CHXHQPMKZWSUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-7-5(2)6(3)8-9-7/h8-9H,3-4H2,1-2H3.
What are the key properties of 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole?
3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole has a molecular weight of 124.19 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-methyl-5-methylidene-1,2-dihydropyrazole is sourced from PubChem (CID 58074465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).