About 3-methyl-5-methylidene-1,2-dihydropyrazole
3-methyl-5-methylidene-1,2-dihydropyrazole (PubChem CID 58074490) has the molecular formula C5H8N2
and a molecular weight of 96.13 g/mol. Its IUPAC name is 3-methyl-5-methylidene-1,2-dihydropyrazole.
Molecular Properties
| Compound Name | 3-methyl-5-methylidene-1,2-dihydropyrazole |
| PubChem CID | 58074490 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | 3-methyl-5-methylidene-1,2-dihydropyrazole |
| SMILES | C=C1C=C(C)NN1 |
| InChI | InChI=1S/C5H8N2/c1-4-3-5(2)7-6-4/h3,6-7H,1H2,2H3 |
| InChIKey | QTJYCGSSAOGHLB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5-methylidene-1,2-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-methylidene-1,2-dihydropyrazole?
The IUPAC name of 3-methyl-5-methylidene-1,2-dihydropyrazole (CID 58074490) is 3-methyl-5-methylidene-1,2-dihydropyrazole.
What is the SMILES notation for 3-methyl-5-methylidene-1,2-dihydropyrazole?
The canonical SMILES for 3-methyl-5-methylidene-1,2-dihydropyrazole is C=C1C=C(C)NN1.
What is the InChIKey of 3-methyl-5-methylidene-1,2-dihydropyrazole?
The InChIKey is QTJYCGSSAOGHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2/c1-4-3-5(2)7-6-4/h3,6-7H,1H2,2H3.
What are the key properties of 3-methyl-5-methylidene-1,2-dihydropyrazole?
3-methyl-5-methylidene-1,2-dihydropyrazole has a molecular weight of 96.13 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-methylidene-1,2-dihydropyrazole is sourced from PubChem (CID 58074490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).