C28H32F3N3O5 — CID 58074504
methyl 6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoate (PubChem CID 58074504) has the molecular formula C28H32F3N3O5 and a molecular weight of 547.57 g/mol. Its IUPAC name is methyl 6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoate.
| Compound Name | methyl 6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 58074504 |
| Molecular Formula | C28H32F3N3O5 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | methyl 6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C(CCC(F)(F)F)c1ccc(CN2N=C(c3ccccc3)OCC2=O)cc1 |
| InChI | InChI=1S/C28H32F3N3O5/c1-38-25(36)10-6-3-7-17-32-26(37)23(15-16-28(29,30)31)21-13-11-20(12-14-21)18-34-24(35)19-39-27(33-34)22-8-4-2-5-9-22/h2,4-5,8-9,11-14,23H,3,6-7,10,15-19H2,1H3,(H,32,37) |
| InChIKey | RMYNZEODLVVQHO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|