C27H30F3N3O5 — CID 58074553
6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoic acid (PubChem CID 58074553) has the molecular formula C27H30F3N3O5 and a molecular weight of 533.55 g/mol. Its IUPAC name is 6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoic acid.
| Compound Name | 6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58074553 |
| Molecular Formula | C27H30F3N3O5 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 6-[[5,5,5-trifluoro-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]pentanoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C(CCC(F)(F)F)c1ccc(CN2N=C(c3ccccc3)OCC2=O)cc1 |
| InChI | InChI=1S/C27H30F3N3O5/c28-27(29,30)15-14-22(25(37)31-16-6-2-5-9-24(35)36)20-12-10-19(11-13-20)17-33-23(34)18-38-26(32-33)21-7-3-1-4-8-21/h1,3-4,7-8,10-13,22H,2,5-6,9,14-18H2,(H,31,37)(H,35,36) |
| InChIKey | AADJXEMPAGKSGN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|