3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid

C10H9N3O2 — CID 58074688

IUPAC3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid
SMILESO=C(O)c1cccn2c(C3CC3)nnc12
InChIInChI=1S/C10H9N3O2/c14-10(15)7-2-1-5-13-8(6-3-4-6)11-12-9(7)13/h1-2,5-6H,3-4H2,(H,14,15)
InChIKeyIACIZECYPGMUNT-UHFFFAOYSA-N
MW203.20 g/mol
LogP1.30
Rot. Bonds2

About 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid

3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid (PubChem CID 58074688) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid.

Molecular Properties

Compound Name3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid
PubChem CID58074688
Molecular FormulaC10H9N3O2
Molecular Weight203.20 g/mol
Exact Mass203.07
IUPAC Name3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid
SMILESO=C(O)c1cccn2c(C3CC3)nnc12
InChIInChI=1S/C10H9N3O2/c14-10(15)7-2-1-5-13-8(6-3-4-6)11-12-9(7)13/h1-2,5-6H,3-4H2,(H,14,15)
InChIKeyIACIZECYPGMUNT-UHFFFAOYSA-N
XLogP1.30
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 51.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid?
The IUPAC name of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid (CID 58074688) is 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid.
What is the SMILES notation for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid?
The canonical SMILES for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid is O=C(O)c1cccn2c(C3CC3)nnc12.
What is the InChIKey of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid?
The InChIKey is IACIZECYPGMUNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c14-10(15)7-2-1-5-13-8(6-3-4-6)11-12-9(7)13/h1-2,5-6H,3-4H2,(H,14,15).
What are the key properties of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid?
3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid is sourced from PubChem (CID 58074688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).