C22H19F3N6 — CID 58074710
N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]isoquinolin-10-amine (PubChem CID 58074710) has the molecular formula C22H19F3N6 and a molecular weight of 424.43 g/mol. Its IUPAC name is N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]isoquinolin-10-amine.
| Compound Name | N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]isoquinolin-10-amine |
|---|---|
| PubChem CID | 58074710 |
| Molecular Formula | C22H19F3N6 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-a]isoquinolin-10-amine |
| SMILES | Cn1c(CCCNc2cccc3ccn4c(C(F)(F)F)nnc4c23)nc2ccccc21 |
| InChI | InChI=1S/C22H19F3N6/c1-30-17-9-3-2-7-15(17)27-18(30)10-5-12-26-16-8-4-6-14-11-13-31-20(19(14)16)28-29-21(31)22(23,24)25/h2-4,6-9,11,13,26H,5,10,12H2,1H3 |
| InChIKey | GCERFOLPBOHOSF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|