C26H27ClFN7O — CID 58075297
2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-N-ethyl-8-(4-fluorophenyl)-4-N-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine (PubChem CID 58075297) has the molecular formula C26H27ClFN7O and a molecular weight of 508.00 g/mol. Its IUPAC name is 2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-N-ethyl-8-(4-fluorophenyl)-4-N-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-N-ethyl-8-(4-fluorophenyl)-4-N-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58075297 |
| Molecular Formula | C26H27ClFN7O |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-4-N-ethyl-8-(4-fluorophenyl)-4-N-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
| SMILES | CCN(C)c1nc(Nc2ccc(-n3cnc(Cl)c3)c(OC)c2)nc2c1CCNC2c1ccc(F)cc1 |
| InChI | InChI=1S/C26H27ClFN7O/c1-4-34(2)25-19-11-12-29-23(16-5-7-17(28)8-6-16)24(19)32-26(33-25)31-18-9-10-20(21(13-18)36-3)35-14-22(27)30-15-35/h5-10,13-15,23,29H,4,11-12H2,1-3H3,(H,31,32,33) |
| InChIKey | FHSAIHYGRYEDBG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |