C14H11ClF3N3 — CID 58075619
2-chloro-N-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 58075619) has the molecular formula C14H11ClF3N3 and a molecular weight of 313.71 g/mol. Its IUPAC name is 2-chloro-N-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 58075619 |
| Molecular Formula | C14H11ClF3N3 |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-chloro-N-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CNc1nc(Cl)nc2c1CCC2c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H11ClF3N3/c1-19-13-8-3-2-7(12(8)20-14(15)21-13)6-4-9(16)11(18)10(17)5-6/h4-5,7H,2-3H2,1H3,(H,19,20,21) |
| InChIKey | IYIJBUGVLWYFLQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|