About 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine
4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine (PubChem CID 58075790) has the molecular formula C14H12Cl2N2O2
and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine.
Molecular Properties
| Compound Name | 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine |
| PubChem CID | 58075790 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine |
| SMILES | Clc1nc(Cl)c(C2OCCO2)c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H12Cl2N2O2/c15-12-11(13-19-6-7-20-13)10(17-14(16)18-12)8-9-4-2-1-3-5-9/h1-5,13H,6-8H2 |
| InChIKey | VPMHZALLGWQRJK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine?
The IUPAC name of 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine (CID 58075790) is 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine.
What is the SMILES notation for 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine?
The canonical SMILES for 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine is Clc1nc(Cl)c(C2OCCO2)c(Cc2ccccc2)n1.
What is the InChIKey of 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine?
The InChIKey is VPMHZALLGWQRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N2O2/c15-12-11(13-19-6-7-20-13)10(17-14(16)18-12)8-9-4-2-1-3-5-9/h1-5,13H,6-8H2.
What are the key properties of 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine?
4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine has a molecular weight of 311.17 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2,6-dichloro-5-(1,3-dioxolan-2-yl)pyrimidine is sourced from PubChem (CID 58075790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).