C40H40F2N8O10 — CID 58075874
(2R,3S)-13-(2,5-difluorophenyl)-3-hydroxy-7,7-dimethyl-2,12-bis[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-1-phenylmethoxytridecane-4,10-dione (PubChem CID 58075874) has the molecular formula C40H40F2N8O10 and a molecular weight of 830.80 g/mol. Its IUPAC name is (2R,3S)-13-(2,5-difluorophenyl)-3-hydroxy-7,7-dimethyl-2,12-bis[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-1-phenylmethoxytridecane-4,10-dione.
| Compound Name | (2R,3S)-13-(2,5-difluorophenyl)-3-hydroxy-7,7-dimethyl-2,12-bis[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-1-phenylmethoxytridecane-4,10-dione |
|---|---|
| PubChem CID | 58075874 |
| Molecular Formula | C40H40F2N8O10 |
| Molecular Weight | 830.80 g/mol |
| Exact Mass | 830.28 |
| IUPAC Name | (2R,3S)-13-(2,5-difluorophenyl)-3-hydroxy-7,7-dimethyl-2,12-bis[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-1-phenylmethoxytridecane-4,10-dione |
| SMILES | CC(C)(CCC(=O)CC(Cc1cc(F)ccc1F)Nc1ccc([N+](=O)[O-])c2nonc12)CCC(=O)[C@@H](O)[C@@H](COCc1ccccc1)Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C40H40F2N8O10/c1-40(2,16-14-27(51)20-26(19-24-18-25(41)8-9-28(24)42)43-29-10-12-32(49(54)55)37-35(29)45-59-47-37)17-15-34(52)39(53)31(22-58-21-23-6-4-3-5-7-23)44-30-11-13-33(50(56)57)38-36(30)46-60-48-38/h3-13,18,26,31,39,43-44,53H,14-17,19-22H2,1-2H3/t26?,31-,39+/m1/s1 |
| InChIKey | LHASSHBBCXNWRT-ZIGAGZTESA-N |
| XLogP | 7.05 |
| TPSA | 251.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|