C25H34F2N2O5S — CID 58075907
2-amino-9-[2-amino-3-(2,5-difluorophenyl)propyl]sulfonyl-3-hydroxy-1-phenylmethoxynonan-4-one (PubChem CID 58075907) has the molecular formula C25H34F2N2O5S and a molecular weight of 512.62 g/mol. Its IUPAC name is 2-amino-9-[2-amino-3-(2,5-difluorophenyl)propyl]sulfonyl-3-hydroxy-1-phenylmethoxynonan-4-one.
| Compound Name | 2-amino-9-[2-amino-3-(2,5-difluorophenyl)propyl]sulfonyl-3-hydroxy-1-phenylmethoxynonan-4-one |
|---|---|
| PubChem CID | 58075907 |
| Molecular Formula | C25H34F2N2O5S |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 2-amino-9-[2-amino-3-(2,5-difluorophenyl)propyl]sulfonyl-3-hydroxy-1-phenylmethoxynonan-4-one |
| SMILES | NC(Cc1cc(F)ccc1F)CS(=O)(=O)CCCCCC(=O)C(O)C(N)COCc1ccccc1 |
| InChI | InChI=1S/C25H34F2N2O5S/c26-20-10-11-22(27)19(13-20)14-21(28)17-35(32,33)12-6-2-5-9-24(30)25(31)23(29)16-34-15-18-7-3-1-4-8-18/h1,3-4,7-8,10-11,13,21,23,25,31H,2,5-6,9,12,14-17,28-29H2 |
| InChIKey | UMWAPMAUGVCEIP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|