C34H44F2N2O7 — CID 58075921
[(2R,3S)-2,12-diacetamido-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate (PubChem CID 58075921) has the molecular formula C34H44F2N2O7 and a molecular weight of 630.73 g/mol. Its IUPAC name is [(2R,3S)-2,12-diacetamido-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate.
| Compound Name | [(2R,3S)-2,12-diacetamido-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate |
|---|---|
| PubChem CID | 58075921 |
| Molecular Formula | C34H44F2N2O7 |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | [(2R,3S)-2,12-diacetamido-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate |
| SMILES | CC(=O)NC(CC(=O)CCC(C)(C)CCC(=O)[C@@H](OC(C)=O)[C@@H](COCc1ccccc1)NC(C)=O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C34H44F2N2O7/c1-22(39)37-28(18-26-17-27(35)11-12-30(26)36)19-29(42)13-15-34(4,5)16-14-32(43)33(45-24(3)41)31(38-23(2)40)21-44-20-25-9-7-6-8-10-25/h6-12,17,28,31,33H,13-16,18-21H2,1-5H3,(H,37,39)(H,38,40)/t28?,31-,33+/m1/s1 |
| InChIKey | ILDQUCLYWSARGQ-KVILRBDLSA-N |
| XLogP | 4.78 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |