C30H43F2N3O4 — CID 58075934
tert-butyl N-[6-[(6-amino-5-hydroxy-4-oxo-7-phenylheptyl)amino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate (PubChem CID 58075934) has the molecular formula C30H43F2N3O4 and a molecular weight of 547.69 g/mol. Its IUPAC name is tert-butyl N-[6-[(6-amino-5-hydroxy-4-oxo-7-phenylheptyl)amino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-[(6-amino-5-hydroxy-4-oxo-7-phenylheptyl)amino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58075934 |
| Molecular Formula | C30H43F2N3O4 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | tert-butyl N-[6-[(6-amino-5-hydroxy-4-oxo-7-phenylheptyl)amino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNCCCC(=O)C(O)C(N)Cc1ccccc1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C30H43F2N3O4/c1-30(2,3)39-29(38)35-24(20-22-19-23(31)14-15-25(22)32)12-7-8-16-34-17-9-13-27(36)28(37)26(33)18-21-10-5-4-6-11-21/h4-6,10-11,14-15,19,24,26,28,34,37H,7-9,12-13,16-18,20,33H2,1-3H3,(H,35,38) |
| InChIKey | KEEMJUBSQMOVAB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|