C35H48F2N2O7 — CID 58075949
[(2R,3S)-12-amino-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate (PubChem CID 58075949) has the molecular formula C35H48F2N2O7 and a molecular weight of 646.77 g/mol. Its IUPAC name is [(2R,3S)-12-amino-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate.
| Compound Name | [(2R,3S)-12-amino-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate |
|---|---|
| PubChem CID | 58075949 |
| Molecular Formula | C35H48F2N2O7 |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | [(2R,3S)-12-amino-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)CCC(C)(C)CCC(=O)CC(N)Cc1cc(F)ccc1F)[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H48F2N2O7/c1-23(40)45-32(30(39-33(43)46-34(2,3)4)22-44-21-24-10-8-7-9-11-24)31(42)15-17-35(5,6)16-14-28(41)20-27(38)19-25-18-26(36)12-13-29(25)37/h7-13,18,27,30,32H,14-17,19-22,38H2,1-6H3,(H,39,43)/t27?,30-,32+/m1/s1 |
| InChIKey | MYCJLZKWMOKNFB-PBWYZZMHSA-N |
| XLogP | 5.99 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |