C38H54F2N2O7 — CID 58075984
[(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(propan-2-ylamino)tridecan-3-yl] acetate (PubChem CID 58075984) has the molecular formula C38H54F2N2O7 and a molecular weight of 688.85 g/mol. Its IUPAC name is [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(propan-2-ylamino)tridecan-3-yl] acetate.
| Compound Name | [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(propan-2-ylamino)tridecan-3-yl] acetate |
|---|---|
| PubChem CID | 58075984 |
| Molecular Formula | C38H54F2N2O7 |
| Molecular Weight | 688.85 g/mol |
| Exact Mass | 688.39 |
| IUPAC Name | [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxy-12-(propan-2-ylamino)tridecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)CCC(C)(C)CCC(=O)CC(Cc1cc(F)ccc1F)NC(C)C)[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H54F2N2O7/c1-25(2)41-30(21-28-20-29(39)14-15-32(28)40)22-31(44)16-18-38(7,8)19-17-34(45)35(48-26(3)43)33(42-36(46)49-37(4,5)6)24-47-23-27-12-10-9-11-13-27/h9-15,20,25,30,33,35,41H,16-19,21-24H2,1-8H3,(H,42,46)/t30?,33-,35+/m1/s1 |
| InChIKey | YOVJYUNSNGTUQX-AWJDTDSASA-N |
| XLogP | 7.03 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.85 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |