C46H68F2N2O7 — CID 58076012
[13-(2,5-difluorophenyl)-2,12-bis(hexanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] hexanoate (PubChem CID 58076012) has the molecular formula C46H68F2N2O7 and a molecular weight of 799.05 g/mol. Its IUPAC name is [13-(2,5-difluorophenyl)-2,12-bis(hexanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] hexanoate.
| Compound Name | [13-(2,5-difluorophenyl)-2,12-bis(hexanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] hexanoate |
|---|---|
| PubChem CID | 58076012 |
| Molecular Formula | C46H68F2N2O7 |
| Molecular Weight | 799.05 g/mol |
| Exact Mass | 798.50 |
| IUPAC Name | [13-(2,5-difluorophenyl)-2,12-bis(hexanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)NC(CC(=O)CCC(C)(C)CCC(=O)C(OC(=O)CCCCC)C(COCc1ccccc1)NC(=O)CCCCC)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C46H68F2N2O7/c1-6-9-13-20-42(53)49-37(30-35-29-36(47)23-24-39(35)48)31-38(51)25-27-46(4,5)28-26-41(52)45(57-44(55)22-15-11-8-3)40(50-43(54)21-14-10-7-2)33-56-32-34-18-16-12-17-19-34/h12,16-19,23-24,29,37,40,45H,6-11,13-15,20-22,25-28,30-33H2,1-5H3,(H,49,53)(H,50,54) |
| InChIKey | SAHNCRUNJQYYAS-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.05 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|