C40H56F2N2O7 — CID 58076017
[(2R,3S)-2,12-bis(butanoylamino)-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] butanoate (PubChem CID 58076017) has the molecular formula C40H56F2N2O7 and a molecular weight of 714.89 g/mol. Its IUPAC name is [(2R,3S)-2,12-bis(butanoylamino)-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] butanoate.
| Compound Name | [(2R,3S)-2,12-bis(butanoylamino)-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] butanoate |
|---|---|
| PubChem CID | 58076017 |
| Molecular Formula | C40H56F2N2O7 |
| Molecular Weight | 714.89 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | [(2R,3S)-2,12-bis(butanoylamino)-13-(2,5-difluorophenyl)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] butanoate |
| SMILES | CCCC(=O)NC(CC(=O)CCC(C)(C)CCC(=O)[C@@H](OC(=O)CCC)[C@@H](COCc1ccccc1)NC(=O)CCC)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C40H56F2N2O7/c1-6-12-36(47)43-31(24-29-23-30(41)17-18-33(29)42)25-32(45)19-21-40(4,5)22-20-35(46)39(51-38(49)14-8-3)34(44-37(48)13-7-2)27-50-26-28-15-10-9-11-16-28/h9-11,15-18,23,31,34,39H,6-8,12-14,19-22,24-27H2,1-5H3,(H,43,47)(H,44,48)/t31?,34-,39+/m1/s1 |
| InChIKey | KVZNIYMGAIDOKW-RDTQKVDSSA-N |
| XLogP | 7.12 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.89 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |