C40H56F2N2O9 — CID 58076031
[(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate (PubChem CID 58076031) has the molecular formula C40H56F2N2O9 and a molecular weight of 746.89 g/mol. Its IUPAC name is [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate.
| Compound Name | [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate |
|---|---|
| PubChem CID | 58076031 |
| Molecular Formula | C40H56F2N2O9 |
| Molecular Weight | 746.89 g/mol |
| Exact Mass | 746.40 |
| IUPAC Name | [(2R,3S)-13-(2,5-difluorophenyl)-7,7-dimethyl-2,12-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4,10-dioxo-1-phenylmethoxytridecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)CCC(C)(C)CCC(=O)CC(Cc1cc(F)ccc1F)NC(=O)OC(C)(C)C)[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H56F2N2O9/c1-26(45)51-35(33(44-37(49)53-39(5,6)7)25-50-24-27-13-11-10-12-14-27)34(47)18-20-40(8,9)19-17-31(46)23-30(43-36(48)52-38(2,3)4)22-28-21-29(41)15-16-32(28)42/h10-16,21,30,33,35H,17-20,22-25H2,1-9H3,(H,43,48)(H,44,49)/t30?,33-,35+/m1/s1 |
| InChIKey | BJAXOHBGUWTKFR-AWJDTDSASA-N |
| XLogP | 7.56 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.89 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|