C43H62F2N2O7 — CID 58076051
[(2R,3S)-13-(2,5-difluorophenyl)-2,12-bis(2,2-dimethylpropanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate (PubChem CID 58076051) has the molecular formula C43H62F2N2O7 and a molecular weight of 756.97 g/mol. Its IUPAC name is [(2R,3S)-13-(2,5-difluorophenyl)-2,12-bis(2,2-dimethylpropanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S)-13-(2,5-difluorophenyl)-2,12-bis(2,2-dimethylpropanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58076051 |
| Molecular Formula | C43H62F2N2O7 |
| Molecular Weight | 756.97 g/mol |
| Exact Mass | 756.45 |
| IUPAC Name | [(2R,3S)-13-(2,5-difluorophenyl)-2,12-bis(2,2-dimethylpropanoylamino)-7,7-dimethyl-4,10-dioxo-1-phenylmethoxytridecan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(CCC(=O)CC(Cc1cc(F)ccc1F)NC(=O)C(C)(C)C)CCC(=O)[C@@H](OC(=O)C(C)(C)C)[C@@H](COCc1ccccc1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C43H62F2N2O7/c1-40(2,3)37(50)46-31(24-29-23-30(44)17-18-33(29)45)25-32(48)19-21-43(10,11)22-20-35(49)36(54-39(52)42(7,8)9)34(47-38(51)41(4,5)6)27-53-26-28-15-13-12-14-16-28/h12-18,23,31,34,36H,19-22,24-27H2,1-11H3,(H,46,50)(H,47,51)/t31?,34-,36+/m1/s1 |
| InChIKey | GMJHZQICUKFVBW-BOKCQITBSA-N |
| XLogP | 7.86 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.97 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |