C12H16N4O4S — CID 58076121
5-amino-3-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-7-methyl-[1,3]thiazolo[4,5-d]pyrimidin-2-one (PubChem CID 58076121) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 5-amino-3-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-7-methyl-[1,3]thiazolo[4,5-d]pyrimidin-2-one.
| Compound Name | 5-amino-3-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-7-methyl-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 58076121 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-amino-3-[(2R,3R,4S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]-7-methyl-[1,3]thiazolo[4,5-d]pyrimidin-2-one |
| SMILES | CC[C@H]1O[C@@H](n2c(=O)sc3c(C)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16N4O4S/c1-3-5-6(17)7(18)10(20-5)16-9-8(21-12(16)19)4(2)14-11(13)15-9/h5-7,10,17-18H,3H2,1-2H3,(H2,13,14,15)/t5-,6-,7-,10-/m1/s1 |
| InChIKey | XYDLEPFMBHFXDP-DAGMQNCNSA-N |
| XLogP | -0.23 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |