About 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole
1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole (PubChem CID 58076328) has the molecular formula C23H20N2O2
and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole |
| PubChem CID | 58076328 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole |
| SMILES | c1ccc(C(c2ccccc2)N2CCN=C2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H20N2O2/c1-3-7-17(8-4-1)22(18-9-5-2-6-10-18)25-14-13-24-23(25)19-11-12-20-21(15-19)27-16-26-20/h1-12,15,22H,13-14,16H2 |
| InChIKey | QPYVFVKTYUNLIB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole?
The IUPAC name of 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole (CID 58076328) is 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole.
What is the SMILES notation for 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole?
The canonical SMILES for 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole is c1ccc(C(c2ccccc2)N2CCN=C2c2ccc3c(c2)OCO3)cc1.
What is the InChIKey of 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole?
The InChIKey is QPYVFVKTYUNLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O2/c1-3-7-17(8-4-1)22(18-9-5-2-6-10-18)25-14-13-24-23(25)19-11-12-20-21(15-19)27-16-26-20/h1-12,15,22H,13-14,16H2.
What are the key properties of 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole?
1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole has a molecular weight of 356.43 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryl-2-(1,3-benzodioxol-5-yl)-4,5-dihydroimidazole is sourced from PubChem (CID 58076328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).