C29H46O4S — CID 58076381
[(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(cyclohexylmethylsulfanyl)acetate (PubChem CID 58076381) has the molecular formula C29H46O4S and a molecular weight of 490.75 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(cyclohexylmethylsulfanyl)acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(cyclohexylmethylsulfanyl)acetate |
|---|---|
| PubChem CID | 58076381 |
| Molecular Formula | C29H46O4S |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(cyclohexylmethylsulfanyl)acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSCC2CCCCC2)[C@]2(C)C(C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H46O4S/c1-6-27(4)16-23(33-24(31)18-34-17-21-10-8-7-9-11-21)28(5)19(2)12-14-29(20(3)26(27)32)15-13-22(30)25(28)29/h6,19-21,23,25-26,32H,1,7-18H2,2-5H3/t19?,20-,23+,25-,26-,27+,28-,29-/m0/s1 |
| InChIKey | JRIUYLHLEYJKOC-INPHLXTBSA-N |
| XLogP | 6.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|