C8H5F13O3 — CID 58076407
1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-(2,2,2-trifluoroethoxy)propane (PubChem CID 58076407) has the molecular formula C8H5F13O3 and a molecular weight of 396.10 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-(2,2,2-trifluoroethoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-(2,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 58076407 |
| Molecular Formula | C8H5F13O3 |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-methoxyethoxy)-3-(2,2,2-trifluoroethoxy)propane |
| SMILES | COC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OCC(F)(F)F |
| InChI | InChI=1S/C8H5F13O3/c1-22-7(18,19)8(20,21)24-4(12,5(13,14)15)6(16,17)23-2-3(9,10)11/h2H2,1H3 |
| InChIKey | GXALKGJCEJKVJH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|