C8H15BrO3 — CID 58076552
(3R,4R,5R)-2-bromo-4,5-dimethoxy-3-methyloxane (PubChem CID 58076552) has the molecular formula C8H15BrO3 and a molecular weight of 239.11 g/mol. Its IUPAC name is (3R,4R,5R)-2-bromo-4,5-dimethoxy-3-methyloxane.
| Compound Name | (3R,4R,5R)-2-bromo-4,5-dimethoxy-3-methyloxane |
|---|---|
| PubChem CID | 58076552 |
| Molecular Formula | C8H15BrO3 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | (3R,4R,5R)-2-bromo-4,5-dimethoxy-3-methyloxane |
| SMILES | CO[C@H]1[C@H](OC)COC(Br)[C@@H]1C |
| InChI | InChI=1S/C8H15BrO3/c1-5-7(11-3)6(10-2)4-12-8(5)9/h5-8H,4H2,1-3H3/t5-,6-,7-,8?/m1/s1 |
| InChIKey | CHDRIWSWYWSGMR-XDTPYFJJSA-N |
| XLogP | 1.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|