C21H18N2O — CID 58077088
2-(3-isocyanophenyl)-5-(3-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 58077088) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(3-isocyanophenyl)-5-(3-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzoxazole.
| Compound Name | 2-(3-isocyanophenyl)-5-(3-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 58077088 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(3-isocyanophenyl)-5-(3-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzoxazole |
| SMILES | [C-]#[N+]c1cccc(-c2nc3c(o2)CCC(c2cccc(C)c2)C3)c1 |
| InChI | InChI=1S/C21H18N2O/c1-14-5-3-6-15(11-14)16-9-10-20-19(13-16)23-21(24-20)17-7-4-8-18(12-17)22-2/h3-8,11-12,16H,9-10,13H2,1H3 |
| InChIKey | AQDQZHABVYOPGY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 30.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|