About tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate
tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate (PubChem CID 58077325) has the molecular formula C23H28Cl2N4O3
and a molecular weight of 479.41 g/mol. Its IUPAC name is tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate |
| PubChem CID | 58077325 |
| Molecular Formula | C23H28Cl2N4O3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate |
| SMILES | CCc1nn(CCCC(=O)OC(C)(C)C)c(Cn2cccn2)c1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H28Cl2N4O3/c1-5-19-22(31-18-13-16(24)12-17(25)14-18)20(15-28-10-7-9-26-28)29(27-19)11-6-8-21(30)32-23(2,3)4/h7,9-10,12-14H,5-6,8,11,15H2,1-4H3 |
| InChIKey | HJEZTFLNWYYDDO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate?
The IUPAC name of tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate (CID 58077325) is tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate.
What is the SMILES notation for tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate?
The canonical SMILES for tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate is CCc1nn(CCCC(=O)OC(C)(C)C)c(Cn2cccn2)c1Oc1cc(Cl)cc(Cl)c1.
What is the InChIKey of tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate?
The InChIKey is HJEZTFLNWYYDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28Cl2N4O3/c1-5-19-22(31-18-13-16(24)12-17(25)14-18)20(15-28-10-7-9-26-28)29(27-19)11-6-8-21(30)32-23(2,3)4/h7,9-10,12-14H,5-6,8,11,15H2,1-4H3.
What are the key properties of tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate?
tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate has a molecular weight of 479.41 g/mol, XLogP of 5.91, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-(3,5-dichlorophenoxy)-3-ethyl-5-(pyrazol-1-ylmethyl)pyrazol-1-yl]butanoate is sourced from PubChem (CID 58077325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).