C12H12Cl2N2O — CID 58077329
4-(3,5-dichlorophenoxy)-1,3,5-trimethylpyrazole (PubChem CID 58077329) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 4-(3,5-dichlorophenoxy)-1,3,5-trimethylpyrazole.
| Compound Name | 4-(3,5-dichlorophenoxy)-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 58077329 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 4-(3,5-dichlorophenoxy)-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O/c1-7-12(8(2)16(3)15-7)17-11-5-9(13)4-10(14)6-11/h4-6H,1-3H3 |
| InChIKey | KBTMVDWMCBXCFC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |