C36H25F9N2O — CID 58077387
2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentylpyrimidine (PubChem CID 58077387) has the molecular formula C36H25F9N2O and a molecular weight of 672.59 g/mol. Its IUPAC name is 2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentylpyrimidine.
| Compound Name | 2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentylpyrimidine |
|---|---|
| PubChem CID | 58077387 |
| Molecular Formula | C36H25F9N2O |
| Molecular Weight | 672.59 g/mol |
| Exact Mass | 672.18 |
| IUPAC Name | 2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(-c2ccc(-c3cc(F)c(/C=C/C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C36H25F9N2O/c1-2-3-4-5-20-18-46-35(47-19-20)21-6-8-25(28(37)12-21)22-13-29(38)27(30(39)14-22)10-11-36(44,45)48-24-7-9-26(31(40)17-24)23-15-32(41)34(43)33(42)16-23/h6-19H,2-5H2,1H3/b11-10+ |
| InChIKey | CIJDOLUNHPJQMR-ZHACJKMWSA-N |
| XLogP | 10.87 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.59 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|