C36H33F7N2O — CID 58077397
2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine (PubChem CID 58077397) has the molecular formula C36H33F7N2O and a molecular weight of 642.66 g/mol. Its IUPAC name is 2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine.
| Compound Name | 2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 58077397 |
| Molecular Formula | C36H33F7N2O |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)pyrimidine |
| SMILES | CCCCCC1CCC(c2cnc(-c3ccc(/C=C/C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C36H33F7N2O/c1-2-3-4-5-22-6-8-23(9-7-22)27-20-44-35(45-21-27)25-11-10-24(30(37)16-25)14-15-36(42,43)46-28-12-13-29(31(38)19-28)26-17-32(39)34(41)33(40)18-26/h10-23H,2-9H2,1H3/b15-14+ |
| InChIKey | CRNPTJZNJFYOAL-CCEZHUSRSA-N |
| XLogP | 11.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|