C37H27F8NO — CID 58077400
2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentylpyridine (PubChem CID 58077400) has the molecular formula C37H27F8NO and a molecular weight of 653.61 g/mol. Its IUPAC name is 2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentylpyridine.
| Compound Name | 2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentylpyridine |
|---|---|
| PubChem CID | 58077400 |
| Molecular Formula | C37H27F8NO |
| Molecular Weight | 653.61 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | 2-[4-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentylpyridine |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(/C=C/C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C37H27F8NO/c1-2-3-4-5-22-6-13-35(46-21-22)24-9-7-23(8-10-24)25-16-30(38)29(31(39)17-25)14-15-37(44,45)47-27-11-12-28(32(40)20-27)26-18-33(41)36(43)34(42)19-26/h6-21H,2-5H2,1H3/b15-14+ |
| InChIKey | SJVUAVJMGNUSBJ-CCEZHUSRSA-N |
| XLogP | 11.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.61 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|