C38H26ClF9O — CID 58077436
1-chloro-2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluoro-5-(4-pentylphenyl)benzene (PubChem CID 58077436) has the molecular formula C38H26ClF9O and a molecular weight of 705.06 g/mol. Its IUPAC name is 1-chloro-2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluoro-5-(4-pentylphenyl)benzene.
| Compound Name | 1-chloro-2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluoro-5-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 58077436 |
| Molecular Formula | C38H26ClF9O |
| Molecular Weight | 705.06 g/mol |
| Exact Mass | 704.15 |
| IUPAC Name | 1-chloro-2-[4-[(E)-3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]-3-fluoro-5-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2cc(F)c(-c3cc(F)c(/C=C/C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C38H26ClF9O/c1-2-3-4-5-21-6-8-22(9-7-21)23-14-29(39)36(33(43)15-23)25-18-30(40)28(31(41)19-25)12-13-38(47,48)49-26-10-11-27(32(42)20-26)24-16-34(44)37(46)35(45)17-24/h6-20H,2-5H2,1H3/b13-12+ |
| InChIKey | QWHUYUOJOGXXIC-OUKQBFOZSA-N |
| XLogP | 12.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.06 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|