C29H33F3N4OS — CID 58077538
1-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(hydroxymethyl)quinolin-4-yl]methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 58077538) has the molecular formula C29H33F3N4OS and a molecular weight of 542.67 g/mol. Its IUPAC name is 1-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(hydroxymethyl)quinolin-4-yl]methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(hydroxymethyl)quinolin-4-yl]methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 58077538 |
| Molecular Formula | C29H33F3N4OS |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 1-[(R)-(5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)-[6-(hydroxymethyl)quinolin-4-yl]methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCC1CN2CCC1CC2[C@H](NC(=S)Nc1cc(C)cc(C(F)(F)F)c1)c1ccnc2ccc(CO)cc12 |
| InChI | InChI=1S/C29H33F3N4OS/c1-3-19-15-36-9-7-20(19)13-26(36)27(23-6-8-33-25-5-4-18(16-37)12-24(23)25)35-28(38)34-22-11-17(2)10-21(14-22)29(30,31)32/h4-6,8,10-12,14,19-20,26-27,37H,3,7,9,13,15-16H2,1-2H3,(H2,34,35,38)/t19?,20?,26?,27-/m1/s1 |
| InChIKey | NSPIPZKWFFAQJK-AQJBBOSWSA-N |
| XLogP | 6.20 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|