C18H26O5S — CID 58077654
(2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol (PubChem CID 58077654) has the molecular formula C18H26O5S and a molecular weight of 354.47 g/mol. Its IUPAC name is (2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 58077654 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H](O)CO)[C@H](C)C1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O5S/c1-3-7-17-16(13(2)18(23-17)10-14(20)11-19)12-24(21,22)15-8-5-4-6-9-15/h3-6,8-9,13-14,16-20H,1,7,10-12H2,2H3/t13-,14+,16?,17+,18-/m1/s1 |
| InChIKey | UIDAYABWAYGENF-WCGWPRRASA-N |
| XLogP | 1.80 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|