C12H20O4 — CID 58077670
(1R,3S,6S,8S)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol (PubChem CID 58077670) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1R,3S,6S,8S)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol.
| Compound Name | (1R,3S,6S,8S)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol |
|---|---|
| PubChem CID | 58077670 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (1R,3S,6S,8S)-3-propyl-2,7,10-trioxatricyclo[6.3.1.01,6]dodecan-9-ol |
| SMILES | CCC[C@H]1CC[C@@H]2O[C@H]3C[C@]2(COC3O)O1 |
| InChI | InChI=1S/C12H20O4/c1-2-3-8-4-5-10-12(16-8)6-9(15-10)11(13)14-7-12/h8-11,13H,2-7H2,1H3/t8-,9-,10-,11?,12+/m0/s1 |
| InChIKey | SCYQKGJQQJDONY-WWJBOSNHSA-N |
| XLogP | 1.21 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |