C22H36O5 — CID 58077702
[(1R)-1-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]propyl] acetate (PubChem CID 58077702) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(1R)-1-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]propyl] acetate.
| Compound Name | [(1R)-1-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]propyl] acetate |
|---|---|
| PubChem CID | 58077702 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [(1R)-1-[(4S,6S,7S,7aS)-7-methyl-6-[(E)-pent-2-enyl]spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]propyl] acetate |
| SMILES | CC/C=C/C[C@@H]1O[C@@H]([C@@H](CC)OC(C)=O)C2OC3(CCCCC3)O[C@H]2[C@H]1C |
| InChI | InChI=1S/C22H36O5/c1-5-7-9-12-18-15(3)19-21(20(25-18)17(6-2)24-16(4)23)27-22(26-19)13-10-8-11-14-22/h7,9,15,17-21H,5-6,8,10-14H2,1-4H3/b9-7+/t15-,17+,18-,19-,20-,21?/m0/s1 |
| InChIKey | VEPHRNMXQPSMQX-MEJPWSSCSA-N |
| XLogP | 4.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|