C19H34O — CID 58077708
(2S,5S)-5-butyl-3-methylidene-2-[(3R,5R)-3,5,6-trimethylhept-6-enyl]oxolane (PubChem CID 58077708) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is (2S,5S)-5-butyl-3-methylidene-2-[(3R,5R)-3,5,6-trimethylhept-6-enyl]oxolane.
| Compound Name | (2S,5S)-5-butyl-3-methylidene-2-[(3R,5R)-3,5,6-trimethylhept-6-enyl]oxolane |
|---|---|
| PubChem CID | 58077708 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (2S,5S)-5-butyl-3-methylidene-2-[(3R,5R)-3,5,6-trimethylhept-6-enyl]oxolane |
| SMILES | C=C(C)[C@H](C)C[C@H](C)CC[C@@H]1O[C@@H](CCCC)CC1=C |
| InChI | InChI=1S/C19H34O/c1-7-8-9-18-13-17(6)19(20-18)11-10-15(4)12-16(5)14(2)3/h15-16,18-19H,2,6-13H2,1,3-5H3/t15-,16-,18+,19+/m1/s1 |
| InChIKey | YONAHJNOUAHNCE-FPAYPSAMSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|