About (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one
(5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one (PubChem CID 58077717) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one.
Molecular Properties
| Compound Name | (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one |
| PubChem CID | 58077717 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one |
| SMILES | C=C1C[C@H](CCCC)OC1CC[C@@H](C)CC(C)C(C)=O |
| InChI | InChI=1S/C18H32O2/c1-6-7-8-17-12-15(4)18(20-17)10-9-13(2)11-14(3)16(5)19/h13-14,17-18H,4,6-12H2,1-3,5H3/t13-,14?,17+,18?/m1/s1 |
| InChIKey | BHOIYHGJUCTHIE-GKWBDSLSSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one?
The IUPAC name of (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one (CID 58077717) is (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one.
What is the SMILES notation for (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one?
The canonical SMILES for (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one is C=C1C[C@H](CCCC)OC1CC[C@@H](C)CC(C)C(C)=O.
What is the InChIKey of (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one?
The InChIKey is BHOIYHGJUCTHIE-GKWBDSLSSA-N. The full InChI is InChI=1S/C18H32O2/c1-6-7-8-17-12-15(4)18(20-17)10-9-13(2)11-14(3)16(5)19/h13-14,17-18H,4,6-12H2,1-3,5H3/t13-,14?,17+,18?/m1/s1.
What are the key properties of (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one?
(5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one has a molecular weight of 280.45 g/mol, XLogP of 4.92, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-7-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-3,5-dimethylheptan-2-one is sourced from PubChem (CID 58077717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).