C38H60O4Si2 — CID 58077725
(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-3-methylheptan-2-one (PubChem CID 58077725) has the molecular formula C38H60O4Si2 and a molecular weight of 637.07 g/mol. Its IUPAC name is (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-3-methylheptan-2-one.
| Compound Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-3-methylheptan-2-one |
|---|---|
| PubChem CID | 58077725 |
| Molecular Formula | C38H60O4Si2 |
| Molecular Weight | 637.07 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-[(5S)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methylideneoxolan-2-yl]-3-methylheptan-2-one |
| SMILES | C=C1C[C@H](CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1CC[C@H](C[C@@H](C)C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H60O4Si2/c1-29(31(3)39)27-33(42-43(10,11)37(4,5)6)24-25-36-30(2)28-32(41-36)19-18-26-40-44(38(7,8)9,34-20-14-12-15-21-34)35-22-16-13-17-23-35/h12-17,20-23,29,32-33,36H,2,18-19,24-28H2,1,3-11H3/t29-,32+,33-,36?/m1/s1 |
| InChIKey | FXNAEEULCRGBMU-NKBMICSJSA-N |
| XLogP | 8.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.07 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|