C15H24INO2 — CID 58077737
(2S,3aS,5R,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran (PubChem CID 58077737) has the molecular formula C15H24INO2 and a molecular weight of 377.27 g/mol. Its IUPAC name is (2S,3aS,5R,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran.
| Compound Name | (2S,3aS,5R,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran |
|---|---|
| PubChem CID | 58077737 |
| Molecular Formula | C15H24INO2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2S,3aS,5R,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran |
| SMILES | [C-]#[N+]CC[C@H]1CC[C@@H]2O[C@@H](CCCC)C[C@]2(CI)O1 |
| InChI | InChI=1S/C15H24INO2/c1-3-4-5-13-10-15(11-16)14(18-13)7-6-12(19-15)8-9-17-2/h12-14H,3-11H2,1H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | KLZKNCWUOLYKGF-CBBWQLFWSA-N |
| XLogP | 4.00 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|