C22H38O4 — CID 58077774
3-[(2S)-5-[(3R)-3-hydroxy-5,6-dimethylhept-6-enyl]-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 58077774) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 3-[(2S)-5-[(3R)-3-hydroxy-5,6-dimethylhept-6-enyl]-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S)-5-[(3R)-3-hydroxy-5,6-dimethylhept-6-enyl]-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58077774 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 3-[(2S)-5-[(3R)-3-hydroxy-5,6-dimethylhept-6-enyl]-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(C)C[C@H](O)CCC1O[C@@H](CCCOC(=O)C(C)(C)C)CC1=C |
| InChI | InChI=1S/C22H38O4/c1-15(2)16(3)13-18(23)10-11-20-17(4)14-19(26-20)9-8-12-25-21(24)22(5,6)7/h16,18-20,23H,1,4,8-14H2,2-3,5-7H3/t16?,18-,19+,20?/m1/s1 |
| InChIKey | NWRCCKDCTYHDAD-BUGOSIMFSA-N |
| XLogP | 4.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|