C17H24O6S — CID 58077776
(2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-hydroxy-5-prop-2-enyloxolan-2-yl]propane-1,2-diol (PubChem CID 58077776) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is (2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-hydroxy-5-prop-2-enyloxolan-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-hydroxy-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 58077776 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2S)-3-[(2R,3R,5S)-4-(benzenesulfonylmethyl)-3-hydroxy-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H](O)CO)[C@H](O)C1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24O6S/c1-2-6-15-14(17(20)16(23-15)9-12(19)10-18)11-24(21,22)13-7-4-3-5-8-13/h2-5,7-8,12,14-20H,1,6,9-11H2/t12-,14?,15-,16+,17+/m0/s1 |
| InChIKey | MYNHFDZCBSFZCV-CJFPBWAHSA-N |
| XLogP | 0.52 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|