C16H30O5Si — CID 58077778
(2S,3S,4R,4aR,6S,8aS)-6-ethyl-2-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol (PubChem CID 58077778) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (2S,3S,4R,4aR,6S,8aS)-6-ethyl-2-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol.
| Compound Name | (2S,3S,4R,4aR,6S,8aS)-6-ethyl-2-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol |
|---|---|
| PubChem CID | 58077778 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (2S,3S,4R,4aR,6S,8aS)-6-ethyl-2-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,4-diol |
| SMILES | CC[C@H]1CC[C@@H]2O[C@@H]([C@@H](O)/C=C/[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C16H30O5Si/c1-5-10-6-7-12-16(20-10)14(19)13(18)15(21-12)11(17)8-9-22(2,3)4/h8-19H,5-7H2,1-4H3/b9-8+/t10-,11-,12-,13-,14+,15-,16-/m0/s1 |
| InChIKey | QNRRRHUVAIZWES-JHQDYLKJSA-N |
| XLogP | 1.23 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|