C13H24O5 — CID 58077806
(1R)-1-[(2R,3aR,5S,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol (PubChem CID 58077806) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (1R)-1-[(2R,3aR,5S,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2R,3aR,5S,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 58077806 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (1R)-1-[(2R,3aR,5S,7aS)-3a-(hydroxymethyl)-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol |
| SMILES | CCC[C@H]1CC[C@@H]2O[C@@H]([C@H](O)CO)C[C@]2(CO)O1 |
| InChI | InChI=1S/C13H24O5/c1-2-3-9-4-5-12-13(8-15,18-9)6-11(17-12)10(16)7-14/h9-12,14-16H,2-8H2,1H3/t9-,10+,11+,12-,13+/m0/s1 |
| InChIKey | JJUGMRDYQLAJFF-CKIKVBCHSA-N |
| XLogP | 0.21 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |