C13H24O3 — CID 58077808
(3aR,5R,6S)-2,2,6-trimethyl-5-(2-methylbutyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 58077808) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (3aR,5R,6S)-2,2,6-trimethyl-5-(2-methylbutyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S)-2,2,6-trimethyl-5-(2-methylbutyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 58077808 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (3aR,5R,6S)-2,2,6-trimethyl-5-(2-methylbutyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC(C)C[C@H]1O[C@@H]2OC(C)(C)OC2[C@H]1C |
| InChI | InChI=1S/C13H24O3/c1-6-8(2)7-10-9(3)11-12(14-10)16-13(4,5)15-11/h8-12H,6-7H2,1-5H3/t8?,9-,10+,11?,12+/m0/s1 |
| InChIKey | HALZZGWURSVHJC-AUCPDYOHSA-N |
| XLogP | 2.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |