C13H18O4 — CID 58077810
(1S,3S,6S,8R,10R,12S)-3-propyl-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-one (PubChem CID 58077810) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1S,3S,6S,8R,10R,12S)-3-propyl-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-one.
| Compound Name | (1S,3S,6S,8R,10R,12S)-3-propyl-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-one |
|---|---|
| PubChem CID | 58077810 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1S,3S,6S,8R,10R,12S)-3-propyl-2,7,11-trioxatetracyclo[6.4.1.01,6.010,12]tridecan-9-one |
| SMILES | CCC[C@H]1CC[C@@H]2O[C@@H]3C[C@@]2(O1)[C@H]1O[C@H]1C3=O |
| InChI | InChI=1S/C13H18O4/c1-2-3-7-4-5-9-13(17-7)6-8(15-9)10(14)11-12(13)16-11/h7-9,11-12H,2-6H2,1H3/t7-,8+,9-,11-,12-,13-/m0/s1 |
| InChIKey | NJBWALDHZKKAFY-WVFRMKMXSA-N |
| XLogP | 1.21 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|